Information card for entry 2223622
| Chemical name |
1,1'-[4-(4-Methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-diyl]diethanone |
| Formula |
C18 H21 N O3 |
| Calculated formula |
C18 H21 N O3 |
| SMILES |
C1(=C(C(C(=C(C)N1)C(=O)C)c1ccc(cc1)OC)C(=O)C)C |
| Title of publication |
1,1'-[4-(4-Methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-diyl]diethanone |
| Authors of publication |
Thenmozhi, M.; Kavitha, T.; Reddy, B. Palakshi; Vijayakumar, V.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2795 |
| a |
12.0781 ± 0.0003 Å |
| b |
8.965 ± 0.0002 Å |
| c |
29.3755 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3180.78 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0739 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.1241 |
| Weighted residual factors for all reflections included in the refinement |
0.1481 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223622.html