Information card for entry 2223626
| Chemical name |
(<i>Z</i>)-Ethyl 3-(2,4,6-trimethylanilino)but-2-enoate |
| Formula |
C15 H21 N O2 |
| Calculated formula |
C15 H21 N O2 |
| SMILES |
O=C(OCC)/C=C(\Nc1c(cc(cc1C)C)C)C |
| Title of publication |
(<i>Z</i>)-Ethyl 3-(2,4,6-trimethylanilino)but-2-enoate |
| Authors of publication |
Amézquita-Valencia, Manuel; Hernández-Ortega, Simón; Suárez-Ortiz, G. Alejandra; Toscano, Rubén Alfredo; Cabrera, Armando |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2728 |
| a |
8.5647 ± 0.0008 Å |
| b |
20.6131 ± 0.0019 Å |
| c |
8.2404 ± 0.0008 Å |
| α |
90° |
| β |
93.976 ± 0.002° |
| γ |
90° |
| Cell volume |
1451.3 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0582 |
| Residual factor for significantly intense reflections |
0.0494 |
| Weighted residual factors for significantly intense reflections |
0.1358 |
| Weighted residual factors for all reflections included in the refinement |
0.145 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223626.html