Information card for entry 2223728
| Chemical name |
<i>N</i>-(1<i>H</i>-1,2,4-Triazol-5-yl)pyridine-2-carboxamide |
| Formula |
C8 H7 N5 O |
| Calculated formula |
C8 H7 N5 O |
| SMILES |
n1c(C(=O)Nc2[nH]ncn2)cccc1 |
| Title of publication |
<i>N</i>-(1<i>H</i>-1,2,4-Triazol-5-yl)pyridine-2-carboxamide |
| Authors of publication |
Miao, Jing; Jia, Maomao; Liu, Xianlin; Xiong, Wei; Chen, Zilu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2738 |
| a |
8.6906 ± 0.0017 Å |
| b |
5.2854 ± 0.001 Å |
| c |
17.88 ± 0.004 Å |
| α |
90° |
| β |
90.7 ± 0.003° |
| γ |
90° |
| Cell volume |
821.2 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0684 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.0978 |
| Weighted residual factors for all reflections included in the refinement |
0.106 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223728.html