Information card for entry 2223849
| Chemical name |
Dimethyl(2,2':6',2''-terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')zinc(II) |
| Formula |
C17 H17 N3 Zn |
| Calculated formula |
C17 H17 N3 Zn |
| SMILES |
C[Zn]12([n]3ccccc3c3[n]1c(c1cccc[n]21)ccc3)C |
| Title of publication |
Dimethyl(2,2':6',2''-terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')zinc(II) |
| Authors of publication |
Shalumova, Tamila; Tanski, Joseph M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
m1325 |
| a |
17.425 ± 0.0011 Å |
| b |
9.1083 ± 0.0006 Å |
| c |
11.7595 ± 0.0014 Å |
| α |
90° |
| β |
127.193 ± 0.001° |
| γ |
90° |
| Cell volume |
1486.8 ± 0.2 Å3 |
| Cell temperature |
125 ± 2 K |
| Ambient diffraction temperature |
125 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0254 |
| Residual factor for significantly intense reflections |
0.0223 |
| Weighted residual factors for significantly intense reflections |
0.0592 |
| Weighted residual factors for all reflections included in the refinement |
0.0608 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.092 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223849.html