Information card for entry 2223870
| Chemical name |
6-(4-Bromophenyl)-2-ethoxy-4-(2,4,6-trimethoxyphenyl)nicotinonitrile |
| Formula |
C23 H21 Br N2 O4 |
| Calculated formula |
C23 H21 Br N2 O4 |
| SMILES |
CCOc1nc(cc(c1C#N)c1c(OC)cc(cc1OC)OC)c1ccc(cc1)Br |
| Title of publication |
6-(4-Bromophenyl)-2-ethoxy-4-(2,4,6-trimethoxyphenyl)nicotinonitrile |
| Authors of publication |
Chantrapromma, Suchada; Fun, Hoong-Kun; Suwunwong, Thitipone; Padaki, Mahesh; Isloor, Arun M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2914 - o2915 |
| a |
14.1799 ± 0.0002 Å |
| b |
18.0877 ± 0.0003 Å |
| c |
16.6881 ± 0.0002 Å |
| α |
90° |
| β |
95.081 ± 0.001° |
| γ |
90° |
| Cell volume |
4263.37 ± 0.11 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0826 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.0794 |
| Weighted residual factors for all reflections included in the refinement |
0.0952 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223870.html