Information card for entry 2224055
| Chemical name |
1-Phenyl-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| Formula |
C18 H18 O4 |
| Calculated formula |
C18 H18 O4 |
| SMILES |
COc1cc(c(c(c1)OC)/C=C/C(=O)c1ccccc1)OC |
| Title of publication |
1-Phenyl-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Wu, Jianzhang; Zhang, Li; Wang, Jing; Yang, Shulin; Li, Xiaokun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2805 |
| a |
9.0052 ± 0.001 Å |
| b |
14.9245 ± 0.0017 Å |
| c |
11.7658 ± 0.0014 Å |
| α |
90° |
| β |
104.315 ± 0.002° |
| γ |
90° |
| Cell volume |
1532.2 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0491 |
| Residual factor for significantly intense reflections |
0.0385 |
| Weighted residual factors for significantly intense reflections |
0.1211 |
| Weighted residual factors for all reflections included in the refinement |
0.1315 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224055.html