Information card for entry 2224090
| Common name |
Bis(ethylenediamine-κ^2^<i>N</i>,<i>N</i>')bis(phenytoinato- κ<i>N</i>)cobalt(II) |
| Chemical name |
bis(2,5-dioxo-4,4-diphenylimidazolidin-1-ido- κ<i>N</i>^1^)bis(ethylenediamine-κ^2^<i>N</i>,<i>N</i>')cobalt(II) |
| Formula |
C34 H38 Co N8 O4 |
| Calculated formula |
C34 H38 Co N8 O4 |
| SMILES |
C1(=O)NC(C(=O)N1[Co]12(N3C(=O)NC(C3=O)(c3ccccc3)c3ccccc3)([NH2]CC[NH2]1)[NH2]CC[NH2]2)(c1ccccc1)c1ccccc1 |
| Title of publication |
Bis(ethylenediamine-κ^2^<i>N</i>,<i>N</i>')bis(phenytoinato-κ<i>N</i>)cobalt(II) |
| Authors of publication |
Hu, Xi-Lan; Xu, Xing-You; Wang, Da-Qi; Zhou, Yan-Qin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
m1470 |
| a |
11.8035 ± 0.0012 Å |
| b |
12.3439 ± 0.0013 Å |
| c |
11.0768 ± 0.001 Å |
| α |
90° |
| β |
92.277 ± 0.001° |
| γ |
90° |
| Cell volume |
1612.6 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0606 |
| Residual factor for significantly intense reflections |
0.0432 |
| Weighted residual factors for significantly intense reflections |
0.1048 |
| Weighted residual factors for all reflections included in the refinement |
0.1203 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.076 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224090.html