Information card for entry 2224280
| Chemical name |
6-Chloro-<i>N</i>^2^,<i>N</i>^4^-di-<i>p</i>-tolyl-1,3,5-triazine-2,4-diamine dimethylformamide monosolvate |
| Formula |
C20 H23 Cl N6 O |
| Calculated formula |
C20 H23 Cl N6 O |
| SMILES |
Clc1nc(Nc2ccc(C)cc2)nc(Nc2ccc(C)cc2)n1.O=CN(C)C |
| Title of publication |
6-Chloro-<i>N</i>^2^,<i>N</i>^4^-di-<i>p</i>-tolyl-1,3,5-triazine-2,4-diamine dimethylformamide monosolvate |
| Authors of publication |
Jian, Fangfang; Xiao, Hailian; Wei, Yongxiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3212 |
| a |
6.821 ± 0.002 Å |
| b |
10.98 ± 0.002 Å |
| c |
14.06 ± 0.003 Å |
| α |
91.13 ± 0.03° |
| β |
94.29 ± 0.02° |
| γ |
98.32 ± 0.04° |
| Cell volume |
1038.5 ± 0.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0704 |
| Residual factor for significantly intense reflections |
0.0499 |
| Weighted residual factors for significantly intense reflections |
0.1283 |
| Weighted residual factors for all reflections included in the refinement |
0.1455 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224280.html