Information card for entry 2224311
| Chemical name |
2-(3,4,5-Trimethoxyphenyl)-1<i>H</i>-pyrrolo[2,3-<i>b</i>]pyridine |
| Formula |
C16 H16 N2 O3 |
| Calculated formula |
C16 H16 N2 O3 |
| SMILES |
[nH]1c(cc2cccnc12)c1cc(c(c(c1)OC)OC)OC |
| Title of publication |
2-(3,4,5-Trimethoxyphenyl)-1<i>H</i>-pyrrolo[2,3-<i>b</i>]pyridine |
| Authors of publication |
Selig, Roland; Schollmeyer, Dieter; Albrecht, Wolfgang; Laufer, Stefan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3097 |
| a |
7.6283 ± 0.0009 Å |
| b |
10.1745 ± 0.0004 Å |
| c |
18.604 ± 0.002 Å |
| α |
90° |
| β |
104.778 ± 0.006° |
| γ |
90° |
| Cell volume |
1396.2 ± 0.2 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0499 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for significantly intense reflections |
0.1205 |
| Weighted residual factors for all reflections included in the refinement |
0.1249 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224311.html