Information card for entry 2224571
| Chemical name |
4-[(1,5-Dibenzyl-2,4-dioxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin- 3-yl)methyl]-1-<i>n</i>-octyl-1<i>H</i>-1,2,3-triazole |
| Formula |
C34 H39 N5 O2 |
| Calculated formula |
C34 H39 N5 O2 |
| SMILES |
O=C1N(c2ccccc2N(C(=O)C1Cc1nnn(c1)CCCCCCCC)Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
4-[(1,5-Dibenzyl-2,4-dioxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin-3-yl)methyl]-1-<i>n</i>-octyl-1<i>H</i>-1,2,3-triazole |
| Authors of publication |
Jabli, Hind; Ouazzani Chahdi, F.; Saffon, Natalie; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
o231 |
| a |
9.1797 ± 0.0002 Å |
| b |
10.4238 ± 0.0002 Å |
| c |
31.4716 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3011.43 ± 0.11 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0804 |
| Residual factor for significantly intense reflections |
0.0568 |
| Weighted residual factors for significantly intense reflections |
0.1531 |
| Weighted residual factors for all reflections included in the refinement |
0.1741 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224571.html