Information card for entry 2224661
| Chemical name |
Chlorido[3,3'-dibutyl-5,5'-(pyridine-2,6-diyl)dipyrazol-1-ido]gold(III) |
| Formula |
C19 H23 Au Cl N5 |
| Calculated formula |
C19 H23 Au Cl N5 |
| SMILES |
[Au]12(n3c(c4[n]1c(c1n2nc(c1)CCCC)ccc4)cc(n3)CCCC)Cl |
| Title of publication |
Chlorido[3,3'-dibutyl-5,5'-(pyridine-2,6-diyl)dipyrazol-1-ido]gold(III) |
| Authors of publication |
Hashmi, A. Stephen K.; Lothschütz, Christian; Rominger, Frank |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
m64 |
| a |
9.0003 ± 0.0003 Å |
| b |
24.222 ± 0.0007 Å |
| c |
9.3042 ± 0.0003 Å |
| α |
90° |
| β |
101.372 ± 0.001° |
| γ |
90° |
| Cell volume |
1988.54 ± 0.11 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0927 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.0764 |
| Weighted residual factors for all reflections included in the refinement |
0.0889 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224661.html