Information card for entry 2224721
| Chemical name |
<i>Tert</i>-butyl 3-oxo-2,3,4,5,6,7-hexahydro-1<i>H</i>- pyrazolo[4,3-<i>c</i>]pyridine-5-carboxylate |
| Formula |
C11 H17 N3 O3 |
| Calculated formula |
C11 H17 N3 O3 |
| SMILES |
O(C(=O)N1CCC2NNC(=O)C=2C1)C(C)(C)C |
| Title of publication |
<i>Tert</i>-butyl 3-oxo-2,3,4,5,6,7-hexahydro-1<i>H</i>-pyrazolo[4,3-<i>c</i>]pyridine-5-carboxylate |
| Authors of publication |
Shahani, Tara; Fun, Hoong-Kun; Ragavan, R. Venkat; Vijayakumar, V.; Sarveswari, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
o142 - o143 |
| a |
18.625 ± 0.0012 Å |
| b |
6.0893 ± 0.0005 Å |
| c |
10.7414 ± 0.0007 Å |
| α |
90° |
| β |
104.1 ± 0.004° |
| γ |
90° |
| Cell volume |
1181.51 ± 0.15 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0733 |
| Residual factor for significantly intense reflections |
0.0542 |
| Weighted residual factors for significantly intense reflections |
0.1487 |
| Weighted residual factors for all reflections included in the refinement |
0.1724 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.236 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224721.html