Information card for entry 2224742
| Chemical name |
<i>catena</i>-Poly[[dianilinedichloridocopper(II)]-μ~2~-2,5- bis(4-pyridyl)-1,3,4-oxadiazole] |
| Formula |
C24 H22 Cl2 Cu N6 O |
| Calculated formula |
C24 H22 Cl2 Cu N6 O |
| SMILES |
[Cu](Cl)(Cl)([NH2]c1ccccc1)([NH2]c1ccccc1)([n]1ccc(cc1)c1oc(nn1)c1cc[n](cc1)[Cu](Cl)(Cl)([NH2]c2ccccc2)[NH2]c2ccccc2)[n]1ccc(cc1)c1oc(nn1)c1ccncc1 |
| Title of publication |
<i>catena</i>-Poly[[dianilinedichloridocopper(II)]-μ~2~-2,5-bis(4-pyridyl)-1,3,4-oxadiazole] |
| Authors of publication |
Meng, Qinglong; Wu, Yiming; Zhang, Chi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
m97 |
| a |
27.028 ± 0.005 Å |
| b |
12.618 ± 0.003 Å |
| c |
6.7904 ± 0.0014 Å |
| α |
90° |
| β |
94.96 ± 0.03° |
| γ |
90° |
| Cell volume |
2307.1 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0354 |
| Residual factor for significantly intense reflections |
0.0332 |
| Weighted residual factors for significantly intense reflections |
0.0838 |
| Weighted residual factors for all reflections included in the refinement |
0.0854 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224742.html