Information card for entry 2224745
| Chemical name |
8-Methyl-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-<i>c</i>]quinoline |
| Formula |
C18 H19 N O |
| Calculated formula |
C18 H19 N O |
| SMILES |
Cc1ccc2c(c1)[C@H]1OCC[C@H]1C(N2)c1ccccc1.Cc1ccc2c(c1)[C@@H]1OCC[C@@H]1C(N2)c1ccccc1 |
| Title of publication |
8-Methyl-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-<i>c</i>]quinoline |
| Authors of publication |
Lu, Pingping; Lian, Chaomei; Zhu, Yulin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
o17 |
| a |
12.751 ± 0.004 Å |
| b |
17.78 ± 0.005 Å |
| c |
17.516 ± 0.004 Å |
| α |
90° |
| β |
132.426 ± 0.014° |
| γ |
90° |
| Cell volume |
2931.3 ± 1.5 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1749 |
| Residual factor for significantly intense reflections |
0.069 |
| Weighted residual factors for significantly intense reflections |
0.1533 |
| Weighted residual factors for all reflections included in the refinement |
0.1858 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.169 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224745.html