Information card for entry 2224787
| Chemical name |
<i>N</i>-(2,4,5-Trichlorophenyl)maleamic acid |
| Formula |
C10 H6 Cl3 N O3 |
| Calculated formula |
C10 H6 Cl3 N O3 |
| SMILES |
O=C(Nc1cc(Cl)c(cc1Cl)Cl)/C=C\C(=O)O |
| Title of publication |
<i>N</i>-(2,4,5-Trichlorophenyl)maleamic acid |
| Authors of publication |
Gowda, B. Thimme; Tokarčík, Miroslav; Kožíšek, Jozef; Shakuntala, K.; Fuess, Hartmut |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
1 |
| Pages of publication |
o182 - o183 |
| a |
10.8979 ± 0.0002 Å |
| b |
11.0225 ± 0.0002 Å |
| c |
19.4739 ± 0.0003 Å |
| α |
90° |
| β |
95.4761 ± 0.0009° |
| γ |
90° |
| Cell volume |
2328.57 ± 0.07 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.033 |
| Residual factor for significantly intense reflections |
0.028 |
| Weighted residual factors for significantly intense reflections |
0.077 |
| Weighted residual factors for all reflections included in the refinement |
0.079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224787.html