Information card for entry 2224866
| Chemical name |
1,3,6-Trimethylpyrano[4,3-<i>b</i>]pyrrol-4(1<i>H</i>)-one |
| Formula |
C10 H11 N O2 |
| Calculated formula |
C10 H11 N O2 |
| SMILES |
n1(cc(c2c(=O)oc(cc12)C)C)C |
| Title of publication |
1,3,6-Trimethylpyrano[4,3-<i>b</i>]pyrrol-4(1<i>H</i>)-one |
| Authors of publication |
Krishnakumar, V.; Khan, F. Nawaz; Hathwar, Venkatesha R.; Nithya, P.; Suresh, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
2 |
| Pages of publication |
o381 |
| a |
7.5556 ± 0.0007 Å |
| b |
8.4819 ± 0.0008 Å |
| c |
14.3081 ± 0.0014 Å |
| α |
90° |
| β |
93.87 ± 0.006° |
| γ |
90° |
| Cell volume |
914.86 ± 0.15 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0733 |
| Residual factor for significantly intense reflections |
0.0505 |
| Weighted residual factors for significantly intense reflections |
0.1696 |
| Weighted residual factors for all reflections included in the refinement |
0.1789 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.176 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224866.html