Information card for entry 2224885
| Chemical name |
6-Bromo-1-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1<i>H</i>- imidazo[4,5-<i>b</i>]pyridin-2(3<i>H</i>)-one |
| Formula |
C11 H11 Br N4 O3 |
| Calculated formula |
C11 H11 Br N4 O3 |
| SMILES |
Brc1cnc2NC(=O)N(CCN3C(=O)OCC3)c2c1 |
| Title of publication |
6-Bromo-1-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-1<i>H</i>-imidazo[4,5-<i>b</i>]pyridin-2(3<i>H</i>)-one |
| Authors of publication |
Bel-Ghacham, H.; Kandri Rodi, Y.; Saffon, Natalie; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
2 |
| Pages of publication |
o456 |
| a |
27.0174 ± 0.0011 Å |
| b |
6.0141 ± 0.0002 Å |
| c |
16.6121 ± 0.0006 Å |
| α |
90° |
| β |
110.343 ± 0.002° |
| γ |
90° |
| Cell volume |
2530.87 ± 0.16 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0653 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.0683 |
| Weighted residual factors for all reflections included in the refinement |
0.077 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224885.html