Information card for entry 2225033
| Chemical name |
Bis(4-bromobenzoyl)(2,7-dimethoxynaphthalene-1,8-diyl)dimethanone |
| Formula |
C26 H18 Br2 O4 |
| Calculated formula |
C26 H18 Br2 O4 |
| SMILES |
Brc1ccc(C(=O)c2c(OC)ccc3ccc(OC)c(c23)C(=O)c2ccc(Br)cc2)cc1 |
| Title of publication |
Bis(4-bromobenzoyl)(2,7-dimethoxynaphthalene-1,8-diyl)dimethanone |
| Authors of publication |
Watanabe, Shoji; Nakaema, Kosuke; Muto, Toyokazu; Okamoto, Akiko; Yonezawa, Noriyuki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
2 |
| Pages of publication |
o403 |
| a |
7.8748 ± 0.0005 Å |
| b |
25.7908 ± 0.0016 Å |
| c |
11.5618 ± 0.0007 Å |
| α |
90° |
| β |
100.982 ± 0.004° |
| γ |
90° |
| Cell volume |
2305.2 ± 0.2 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0407 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Weighted residual factors for all reflections included in the refinement |
0.1032 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225033.html