Information card for entry 2225084
| Chemical name |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)ethane-1,2-diaminium- κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato- κ^2^<i>O</i>,<i>O</i>')erbium(III) |
| Formula |
C18 H20 Er N5 O13 |
| Calculated formula |
C18 H20 Er N5 O13 |
| SMILES |
c12c3cccc1=CNCCNC=c1cccc4c1=[O][Er]156(ON(=[O]5)=O)(ON(=O)=[O]6)([O]=2)([O]3C)([O]4C)ON(=O)=[O]1 |
| Title of publication |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)ethane-1,2-diaminium-κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato-κ^2^<i>O</i>,<i>O</i>')erbium(III) |
| Authors of publication |
Gao, Ting; Li, Guang-Ming; Gao, Po; Yan, Peng-Fei; Hou, Guang-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
2 |
| Pages of publication |
m107 |
| a |
14.098 ± 0.003 Å |
| b |
11.865 ± 0.002 Å |
| c |
14.571 ± 0.003 Å |
| α |
90° |
| β |
103.98 ± 0.03° |
| γ |
90° |
| Cell volume |
2365.1 ± 0.9 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0263 |
| Residual factor for significantly intense reflections |
0.0217 |
| Weighted residual factors for significantly intense reflections |
0.0473 |
| Weighted residual factors for all reflections included in the refinement |
0.0486 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225084.html