Information card for entry 2225236
| Common name |
1,5-Di-(4-methoxyphenyl)-3-hexahydrocyclopentaquinolylbiuret |
| Chemical name |
3-(2,3,5,6,7,8-Hexahydro- 1<i>H</i>-cyclopenta[<i>b</i>]quinolin-9-yl)-1,5-bis(4-methoxyphenyl)biuret |
| Formula |
C28 H30 N4 O4 |
| Calculated formula |
C28 H30 N4 O4 |
| SMILES |
O=C(N(c1c2c(nc3c1CCC3)CCCC2)C(=O)Nc1ccc(OC)cc1)Nc1ccc(OC)cc1 |
| Title of publication |
3-(2,3,5,6,7,8-Hexahydro-1<i>H</i>-cyclopenta[<i>b</i>]quinolin-9-yl)-1,5-bis(4-methoxyphenyl)biuret |
| Authors of publication |
Sakurai, Kaori; Noguchi, Keiichi; Nishibe, Koichiro |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
3 |
| Pages of publication |
o655 |
| a |
22.4514 ± 0.0004 Å |
| b |
12.7128 ± 0.0002 Å |
| c |
8.83183 ± 0.00016 Å |
| α |
90° |
| β |
105.526 ± 0.001° |
| γ |
90° |
| Cell volume |
2428.8 ± 0.07 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0287 |
| Residual factor for significantly intense reflections |
0.0279 |
| Weighted residual factors for significantly intense reflections |
0.071 |
| Weighted residual factors for all reflections included in the refinement |
0.0716 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.091 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225236.html