Information card for entry 2225304
| Chemical name |
Bis(1<i>H</i>-imidazole-κ<i>N</i>^3^){2,2'-[propane-1,2- diylbis(nitrilomethylidyne)]diphenolato- κ^4^<i>O</i>,<i>N</i>,<i>N</i>',<i>O</i>'}iron(III) perchlorate |
| Formula |
C23 H24 Cl Fe N6 O6 |
| Calculated formula |
C23 H24 Cl Fe N6 O6 |
| SMILES |
[Fe]123(Oc4c(C=[N]2C(C)C[N]3=Cc2ccccc2O1)cccc4)([n]1c[nH]cc1)[n]1c[nH]cc1.Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Bis(1<i>H</i>-imidazole-κ<i>N</i>^3^){2,2'-[propane-1,2-diylbis(nitrilomethylidyne)]diphenolato-κ^4^<i>O</i>,<i>N</i>,<i>N</i>',<i>O</i>'}iron(III) perchlorate |
| Authors of publication |
Kojima, Yoshihiro; Kato, Kazuya; Yamamoto, Yuuki; Inoue, Katsuya; Hayami, Shinya |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
3 |
| Pages of publication |
m302 - m303 |
| a |
10.4898 ± 0.0008 Å |
| b |
16.4312 ± 0.0009 Å |
| c |
14.7729 ± 0.0008 Å |
| α |
90° |
| β |
105.508 ± 0.0017° |
| γ |
90° |
| Cell volume |
2453.6 ± 0.3 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1214 |
| Residual factor for significantly intense reflections |
0.065 |
| Weighted residual factors for significantly intense reflections |
0.1569 |
| Weighted residual factors for all reflections included in the refinement |
0.1794 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.989 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225304.html