Information card for entry 2225310
| Chemical name |
6,6'-Dimethoxy-2,2'-[4,5-dimethyl-<i>o</i>-phenylenebis(nitrilomethylidyne)]diphenol monohydrate |
| Formula |
C24 H26 N2 O5 |
| Calculated formula |
C24 H26 N2 O5 |
| SMILES |
Oc1c(OC)cccc1/C=N/c1cc(c(cc1/N=C/c1cccc(OC)c1O)C)C.O |
| Title of publication |
6,6'-Dimethoxy-2,2'-[4,5-dimethyl-<i>o</i>-phenylenebis(nitrilomethylidyne)]diphenol monohydrate |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Ullah Khan, Islam; Sahraei, Atefeh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
3 |
| Pages of publication |
o539 |
| a |
8.7431 ± 0.0005 Å |
| b |
10.3049 ± 0.0006 Å |
| c |
13.6614 ± 0.0007 Å |
| α |
69.556 ± 0.003° |
| β |
83.846 ± 0.003° |
| γ |
70.28 ± 0.003° |
| Cell volume |
1085.6 ± 0.11 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1033 |
| Residual factor for significantly intense reflections |
0.0462 |
| Weighted residual factors for significantly intense reflections |
0.1158 |
| Weighted residual factors for all reflections included in the refinement |
0.1413 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.005 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225310.html