Information card for entry 2225363
| Chemical name |
1,3,3-trimethyl-5-nitro-1-phenylindane |
| Formula |
C18 H19 N O2 |
| Calculated formula |
C18 H19 N O2 |
| SMILES |
O=N(=O)c1ccc2c(c1)C(CC2(C)c1ccccc1)(C)C |
| Title of publication |
1,3,3-Trimethyl-5-nitro-1-phenylindane |
| Authors of publication |
Ma, Xiao-Yan; Wu, Di-Feng; Wang, Yang; Gao, Guo-Wei; Men, Jian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
3 |
| Pages of publication |
o645 |
| a |
8.306 ± 0.003 Å |
| b |
17.6 ± 0.003 Å |
| c |
12.09 ± 0.004 Å |
| α |
90° |
| β |
120.5 ± 0.03° |
| γ |
90° |
| Cell volume |
1522.8 ± 0.9 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1195 |
| Residual factor for significantly intense reflections |
0.0573 |
| Weighted residual factors for significantly intense reflections |
0.1682 |
| Weighted residual factors for all reflections included in the refinement |
0.1954 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.12 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225363.html