Information card for entry 2225391
| Chemical name |
Dichlorido(2,4,6-tri-2-pyridyl-1,3,5-triazine)manganese(II) |
| Formula |
C18 H12 Cl2 Mn N6 |
| Calculated formula |
C18 H12 Cl2 Mn N6 |
| SMILES |
[Mn]12(Cl)(Cl)[n]3c(nc(nc3c3[n]2cccc3)c2ncccc2)c2[n]1cccc2 |
| Title of publication |
Dichlorido(2,4,6-tri-2-pyridyl-1,3,5-triazine)manganese(II) |
| Authors of publication |
Ha, Kwang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
3 |
| Pages of publication |
m262 |
| a |
8.8247 ± 0.0007 Å |
| b |
10.5538 ± 0.0009 Å |
| c |
10.9635 ± 0.0009 Å |
| α |
66.572 ± 0.002° |
| β |
75.812 ± 0.002° |
| γ |
82.867 ± 0.002° |
| Cell volume |
907.91 ± 0.13 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.149 |
| Residual factor for significantly intense reflections |
0.061 |
| Weighted residual factors for significantly intense reflections |
0.111 |
| Weighted residual factors for all reflections included in the refinement |
0.163 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225391.html