Information card for entry 2225452
| Chemical name |
2-Hydroxy-10-propargylpyrrolo[2,1-<i>c</i>][1,4]benzodiazepine-5,11-dione monohydrate |
| Formula |
C15 H16 N2 O4 |
| Calculated formula |
C15 H16 N2 O4 |
| SMILES |
O=C1N(c2ccccc2C(=O)N2C[C@H](O)C[C@@H]12)CC#C.O |
| Title of publication |
2-Hydroxy-10-propargylpyrrolo[2,1-<i>c</i>][1,4]benzodiazepine-5,11-dione monohydrate |
| Authors of publication |
Ourahou, S.; Chammache, M.; Zouihri, H.; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o731 |
| a |
6.8977 ± 0.0001 Å |
| b |
7.9761 ± 0.0001 Å |
| c |
13.068 ± 0.0002 Å |
| α |
90° |
| β |
99.194 ± 0.001° |
| γ |
90° |
| Cell volume |
709.722 ± 0.018 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0311 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0824 |
| Weighted residual factors for all reflections included in the refinement |
0.0943 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225452.html