Information card for entry 2225478
| Chemical name |
1-[3-(4-Methoxyphenyl)-6-methyl-1,6-dihydro-1,2,4,5-tetrazin-1-yl]propanone |
| Formula |
C13 H16 N4 O2 |
| Calculated formula |
C13 H16 N4 O2 |
| SMILES |
O(c1ccc(cc1)C1=NN(C(N=N1)C)C(=O)CC)C |
| Title of publication |
1-[3-(4-Methoxyphenyl)-6-methyl-1,6-dihydro-1,2,4,5-tetrazin-1-yl]propanone |
| Authors of publication |
Yang, Zhen-zhen; Xu, Feng; Chen, Hong-yun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o969 |
| a |
8.345 ± 0.002 Å |
| b |
8.4898 ± 0.0019 Å |
| c |
10.245 ± 0.003 Å |
| α |
113.232 ± 0.006° |
| β |
99.82 ± 0.015° |
| γ |
93.268 ± 0.011° |
| Cell volume |
651 ± 0.3 Å3 |
| Cell temperature |
93 ± 2 K |
| Ambient diffraction temperature |
93 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0523 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.0764 |
| Weighted residual factors for all reflections included in the refinement |
0.0814 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.998 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225478.html