Information card for entry 2225535
| Chemical name |
1,3-Dibenzyl-6-bromo-1<i>H</i>-imidazo[4,5-<i>b</i>]pyridin-2(3<i>H</i>)-one |
| Formula |
C20 H16 Br N3 O |
| Calculated formula |
C20 H16 Br N3 O |
| SMILES |
Brc1cnc2N(C(=O)N(c2c1)Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
1,3-Dibenzyl-6-bromo-1<i>H</i>-imidazo[4,5-<i>b</i>]pyridin-2(3<i>H</i>)-one |
| Authors of publication |
Dahmani, S.; Kandri Rodi, Y.; Capet, F.; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o754 |
| a |
9.1627 ± 0.0001 Å |
| b |
25.5071 ± 0.0003 Å |
| c |
8.0629 ± 0.0001 Å |
| α |
90° |
| β |
115.571 ± 0.001° |
| γ |
90° |
| Cell volume |
1699.84 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.062 |
| Residual factor for significantly intense reflections |
0.0408 |
| Weighted residual factors for significantly intense reflections |
0.116 |
| Weighted residual factors for all reflections included in the refinement |
0.138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225535.html