Information card for entry 2225693
| Chemical name |
(μ-1,4,7,10-Tetraoxacyclododecane)bis[(1,4,7,10-tetraoxacyclododecane)lithium] bis(perchlorate) |
| Formula |
C24 H48 Cl2 Li2 O20 |
| Calculated formula |
C24 H48 Cl2 Li2 O20 |
| SMILES |
[Li]123([O]4CC[O]1CC[O]2CC[O]3CC4)[O]1CCOCC[O](CCOCC1)[Li]123[O]4CC[O]1CC[O]2CC[O]3CC4.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O |
| Title of publication |
(μ-1,4,7,10-Tetraoxacyclododecane)bis[(1,4,7,10-tetraoxacyclododecane)lithium] bis(perchlorate) |
| Authors of publication |
Guzei, Ilia A.; Spencer, Lara C.; Xiao, Lingyun; Burnette, Ronald R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
m438 - m439 |
| a |
7.7395 ± 0.0007 Å |
| b |
14.1924 ± 0.0013 Å |
| c |
15.2801 ± 0.0014 Å |
| α |
90° |
| β |
95.962 ± 0.002° |
| γ |
90° |
| Cell volume |
1669.3 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0366 |
| Residual factor for significantly intense reflections |
0.0339 |
| Weighted residual factors for significantly intense reflections |
0.0899 |
| Weighted residual factors for all reflections included in the refinement |
0.0923 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225693.html