Information card for entry 2225711
| Chemical name |
(<i>E</i>)-3-(2,3,4,5,6-Pentafluorostyryl)thiophene |
| Formula |
C12 H5 F5 S |
| Calculated formula |
C12 H5 F5 S |
| SMILES |
s1cc(cc1)/C=C/c1c(F)c(F)c(F)c(F)c1F |
| Title of publication |
(<i>E</i>)-3-(2,3,4,5,6-Pentafluorostyryl)thiophene |
| Authors of publication |
Clément, Sébastien; Coulembier, Olivier; Meyer, Franck; Zeller, Matthias; Vande Velde, Christophe M. L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o896 - o897 |
| a |
5.8097 ± 0.0015 Å |
| b |
24.581 ± 0.006 Å |
| c |
7.3224 ± 0.0018 Å |
| α |
90° |
| β |
94.953 ± 0.004° |
| γ |
90° |
| Cell volume |
1041.8 ± 0.5 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0995 |
| Residual factor for significantly intense reflections |
0.0864 |
| Weighted residual factors for significantly intense reflections |
0.181 |
| Weighted residual factors for all reflections included in the refinement |
0.1855 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.206 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225711.html