Information card for entry 2225726
| Chemical name |
10-(1,3-Benzothiazol-2-yl)-1,1,7,7-tetramethyl-2,3,6,7-tetrahydro- 1<i>H</i>,5<i>H</i>,11<i>H</i>-pyrano[3,2-<i>g</i>]pyrido[3,2,1- <i>hi</i>]quinoline |
| Formula |
C26 H26 N2 O2 S |
| Calculated formula |
C26 H26 N2 O2 S |
| SMILES |
s1c(nc2ccccc12)c1cc2c(oc1=O)c1c3N(CCC(c3c2)(C)C)CCC1(C)C |
| Title of publication |
10-(1,3-Benzothiazol-2-yl)-1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1<i>H</i>,5<i>H</i>,11<i>H</i>-pyrano[3,2-<i>g</i>]pyrido[3,2,1-<i>hi</i>]quinoline |
| Authors of publication |
Park, Ki-Min; Kang, Youngjin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o963 |
| a |
9.218 ± 0.0004 Å |
| b |
13.7079 ± 0.0006 Å |
| c |
18.6885 ± 0.0006 Å |
| α |
90° |
| β |
115.89 ± 0.002° |
| γ |
90° |
| Cell volume |
2124.46 ± 0.15 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0441 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0922 |
| Weighted residual factors for all reflections included in the refinement |
0.0995 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225726.html