Information card for entry 2225730
| Chemical name |
4-[(2,5-Dimethyl-1,3-thiazol-4-yl)methyl]-4-hydroxy-2-methylisoquinoline- 1,3(2<i>H</i>,4<i>H</i>)-dione |
| Formula |
C16 H16 N2 O3 S |
| Calculated formula |
C16 H16 N2 O3 S |
| SMILES |
s1c(c(nc1C)CC1(O)C(=O)N(C(=O)c2ccccc12)C)C |
| Title of publication |
4-[(2,5-Dimethyl-1,3-thiazol-4-yl)methyl]-4-hydroxy-2-methylisoquinoline-1,3(2<i>H</i>,4<i>H</i>)-dione |
| Authors of publication |
Fun, Hoong-Kun; Goh, Jia Hao; Yu, Haitao; Zhang, Yan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o964 - o965 |
| a |
8.5793 ± 0.0002 Å |
| b |
10.4438 ± 0.0002 Å |
| c |
17.5496 ± 0.0003 Å |
| α |
90° |
| β |
114.304 ± 0.001° |
| γ |
90° |
| Cell volume |
1433.09 ± 0.05 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0518 |
| Residual factor for significantly intense reflections |
0.0405 |
| Weighted residual factors for significantly intense reflections |
0.1091 |
| Weighted residual factors for all reflections included in the refinement |
0.1348 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.33 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225730.html