Information card for entry 2225786
| Chemical name |
1,8-Dihydroxy-2,4,5,7-tetranitro-9,10-anthraquinone |
| Formula |
C14 H4 N4 O12 |
| Calculated formula |
C14 H4 N4 O12 |
| SMILES |
Oc1c2C(=O)c3c(O)c(N(=O)=O)cc(N(=O)=O)c3C(=O)c2c(N(=O)=O)cc1N(=O)=O |
| Title of publication |
1,8-Dihydroxy-2,4,5,7-tetranitro-9,10-anthraquinone |
| Authors of publication |
Armaghan, Mahsa; Amini, Mostafa M.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
5 |
| Pages of publication |
o1164 |
| a |
17.726 ± 0.002 Å |
| b |
9.007 ± 0.001 Å |
| c |
9.731 ± 0.001 Å |
| α |
90° |
| β |
102.643 ± 0.002° |
| γ |
90° |
| Cell volume |
1516 ± 0.3 Å3 |
| Cell temperature |
223 ± 2 K |
| Ambient diffraction temperature |
223 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0796 |
| Residual factor for significantly intense reflections |
0.0626 |
| Weighted residual factors for significantly intense reflections |
0.1949 |
| Weighted residual factors for all reflections included in the refinement |
0.2149 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225786.html