Information card for entry 2225884
| Chemical name |
3,3'-Dibromo-6,6'-dimethoxybiphenyl-2,2'-dicarboxylic acid ethanol monosolvate |
| Formula |
C18 H18 Br2 O7 |
| Calculated formula |
C18 H18 Br2 O7 |
| SMILES |
Brc1c(c(c2c(c(Br)ccc2OC)C(=O)O)c(cc1)OC)C(=O)O.C(C)O |
| Title of publication |
3,3'-Dibromo-6,6'-dimethoxybiphenyl-2,2'-dicarboxylic acid ethanol monosolvate |
| Authors of publication |
Zhang, Xiao; Li, Long; Zhou, Le; Ji, Baoming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
5 |
| Pages of publication |
o1144 |
| a |
9.9872 ± 0.0009 Å |
| b |
23.23 ± 0.002 Å |
| c |
8.3967 ± 0.0007 Å |
| α |
90° |
| β |
90.143 ± 0.001° |
| γ |
90° |
| Cell volume |
1948.1 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0455 |
| Residual factor for significantly intense reflections |
0.0294 |
| Weighted residual factors for significantly intense reflections |
0.0627 |
| Weighted residual factors for all reflections included in the refinement |
0.0687 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225884.html