Information card for entry 2225894
| Chemical name |
{<i>N</i>-[(2-Oxido-1-naphthyl)methylidene]serinato- κ^3^<i>O</i>,<i>N</i>,<i>O</i>'}(1,10-phenanthroline- κ^2^<i>N</i>,<i>N</i>')copper(II) |
| Formula |
C26 H19 Cu N3 O4 |
| Calculated formula |
C26 H19 Cu N3 O4 |
| SMILES |
[Cu]123([N]([C@H](C(=O)O2)CO)=Cc2c(O3)ccc3c2cccc3)[n]2cccc3c2c2[n]1cccc2cc3 |
| Title of publication |
{<i>N</i>-[(2-Oxido-1-naphthyl)methylidene]serinato-κ^3^<i>O</i>,<i>N</i>,<i>O</i>'}(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) |
| Authors of publication |
Li, Jinghong; Guo, Zhenghua; Li, Lianzhi; Wang, Daqi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
5 |
| Pages of publication |
m516 |
| a |
10.7302 ± 0.0012 Å |
| b |
6.4687 ± 0.0006 Å |
| c |
15.793 ± 0.0017 Å |
| α |
90° |
| β |
91.924 ± 0.001° |
| γ |
90° |
| Cell volume |
1095.6 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0506 |
| Residual factor for significantly intense reflections |
0.0412 |
| Weighted residual factors for significantly intense reflections |
0.0903 |
| Weighted residual factors for all reflections included in the refinement |
0.0941 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.973 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225894.html