Information card for entry 2226002
| Chemical name |
<i>N</i>-(3,4-Difluorophenyl)-3,4,5-trimethoxybenzamide |
| Formula |
C16 H15 F2 N O4 |
| Calculated formula |
C16 H15 F2 N O4 |
| SMILES |
c1(cc(c(c(c1)OC)OC)OC)C(=O)Nc1cc(c(cc1)F)F |
| Title of publication |
<i>N</i>-(3,4-Difluorophenyl)-3,4,5-trimethoxybenzamide |
| Authors of publication |
Choi, Hyeong; Han, Byung Hee; Lee, Taewoo; Kang, Sung Kwon; Sung, Chang Keun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
5 |
| Pages of publication |
o1142 |
| a |
5.0031 ± 0.0003 Å |
| b |
8.8986 ± 0.0005 Å |
| c |
32.726 ± 0.002 Å |
| α |
90° |
| β |
93.896 ± 0.004° |
| γ |
90° |
| Cell volume |
1453.61 ± 0.15 Å3 |
| Cell temperature |
174 ± 2 K |
| Ambient diffraction temperature |
174 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for significantly intense reflections |
0.0651 |
| Weighted residual factors for all reflections included in the refinement |
0.1846 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226002.html