Information card for entry 2226051
| Chemical name |
1-chloroacetyl-2,6-bis(2-chlorophenyl)-3,5-dimethyl-piperidin-4-one oxime |
| Formula |
C21 H21 Cl3 N2 O2 |
| Calculated formula |
C21 H21 Cl3 N2 O2 |
| SMILES |
ClCC(=O)N1[C@@H]([C@H](C(=N\O)/[C@H]([C@@H]1c1c(Cl)cccc1)C)C)c1c(Cl)cccc1.ClCC(=O)N1[C@H]([C@@H](C(=N\O)/[C@@H]([C@H]1c1c(Cl)cccc1)C)C)c1c(Cl)cccc1 |
| Title of publication |
1-Chloroacetyl-2,6-bis(2-chlorophenyl)-3,5-dimethylpiperidin-4-one oxime |
| Authors of publication |
Ravichandran, K.; Ramesh, P.; Rani, M.; Kabilan, S.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1506 |
| a |
9.8147 ± 0.0006 Å |
| b |
15.5929 ± 0.0011 Å |
| c |
13.9498 ± 0.0009 Å |
| α |
90° |
| β |
93.529 ± 0.004° |
| γ |
90° |
| Cell volume |
2130.8 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0368 |
| Residual factor for significantly intense reflections |
0.0306 |
| Weighted residual factors for significantly intense reflections |
0.0728 |
| Weighted residual factors for all reflections included in the refinement |
0.0764 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226051.html