Information card for entry 2226055
| Chemical name |
Ethyl 4-(3-ethyl-5-oxo-4,5-dihydro-1<i>H</i>-1,2,4-triazol-4-yl)benzoate |
| Formula |
C13 H15 N3 O3 |
| Calculated formula |
C13 H15 N3 O3 |
| SMILES |
C1(=O)NN=C(CC)N1c1ccc(cc1)C(=O)OCC |
| Title of publication |
Ethyl 4-(3-ethyl-5-oxo-4,5-dihydro-1<i>H</i>-1,2,4-triazol-4-yl)benzoate |
| Authors of publication |
Ünver, Yasemin; Köysal, Yavuz; Tanak, Hasan; Ünlüer, Dilek; Işık, Şamil |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1294 |
| a |
13.6111 ± 0.0011 Å |
| b |
4.097 ± 0.0002 Å |
| c |
24.172 ± 0.002 Å |
| α |
90° |
| β |
100.063 ± 0.007° |
| γ |
90° |
| Cell volume |
1327.21 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0776 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.0844 |
| Weighted residual factors for all reflections included in the refinement |
0.0948 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.928 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226055.html