Information card for entry 2226097
| Chemical name |
2-(2-Nitroanilino)-5,6,7,8-tetrahydro-4<i>H</i>-cyclohepta[<i>b</i>]thiophene- 3-carbonitrile |
| Formula |
C16 H15 N3 O2 S |
| Calculated formula |
C16 H15 N3 O2 S |
| SMILES |
s1c(Nc2c(N(=O)=O)cccc2)c(c2CCCCCc12)C#N |
| Title of publication |
2-(2-Nitroanilino)-5,6,7,8-tetrahydro-4<i>H</i>-cyclohepta[<i>b</i>]thiophene-3-carbonitrile |
| Authors of publication |
do Lima, Maria; Mendonça Junior, Francisco J. B.; Galdino, Suely L.; Pitta, Ivan R.; de Simone, Carlos A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1350 - o1351 |
| a |
7.0273 ± 0.0003 Å |
| b |
14.4569 ± 0.0006 Å |
| c |
14.8867 ± 0.0007 Å |
| α |
90° |
| β |
97.571 ± 0.002° |
| γ |
90° |
| Cell volume |
1499.2 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0658 |
| Residual factor for significantly intense reflections |
0.0516 |
| Weighted residual factors for significantly intense reflections |
0.1484 |
| Weighted residual factors for all reflections included in the refinement |
0.1621 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226097.html