Information card for entry 2226138
| Chemical name |
4-Chloro-<i>N</i>-[3-methyl-1-(5-thioxo-4,5-dihydro-1,3,4-oxadiazol-2- yl)butyl]benzamide |
| Formula |
C14 H16 Cl N3 O2 S |
| Calculated formula |
C14 H16 Cl N3 O2 S |
| SMILES |
Clc1ccc(C(=O)N[C@H](C2=NNC(=S)O2)CC(C)C)cc1 |
| Title of publication |
4-Chloro-<i>N</i>-[3-methyl-1-(5-thioxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)butyl]benzamide |
| Authors of publication |
Yan, Yu-Gang; Tu, Guo-Gang; Wang, Ling-Dong; Liu, Jian; Li, Shao-Hua |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1381 |
| a |
6.0171 ± 0.0006 Å |
| b |
15.312 ± 0.0015 Å |
| c |
18.1493 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1672.2 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1222 |
| Residual factor for significantly intense reflections |
0.0495 |
| Weighted residual factors for significantly intense reflections |
0.0773 |
| Weighted residual factors for all reflections included in the refinement |
0.1079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226138.html