Information card for entry 2226150
| Chemical name |
4-(3,4-Dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-2-methoxyphenol |
| Formula |
C18 H21 N O3 |
| Calculated formula |
C18 H21 N O3 |
| SMILES |
Oc1ccc(cc1OC)[C@@H]1O[C@H]([C@@H](N1C)C)c1ccccc1 |
| Title of publication |
4-(3,4-Dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-2-methoxyphenol |
| Authors of publication |
Asaruddin, Mohd Razip; Wahab, Habibah A.; Mohamed, Nornisah; Goh, Jia Hao; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1452 - o1453 |
| a |
7.8893 ± 0.0006 Å |
| b |
11.7697 ± 0.0009 Å |
| c |
17.4392 ± 0.0013 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1619.3 ± 0.2 Å3 |
| Cell temperature |
120 ± 0.1 K |
| Ambient diffraction temperature |
120 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.074 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.0814 |
| Weighted residual factors for all reflections included in the refinement |
0.0958 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226150.html