Information card for entry 2226173
| Chemical name |
Bis(4,7-dichloro-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(dicyanamido- κ<i>N</i>)copper(II) |
| Formula |
C28 H12 Cl4 Cu N10 |
| Calculated formula |
C28 H12 Cl4 Cu N10 |
| SMILES |
[Cu]12([n]3c4c(c(Cl)cc3)ccc3c4[n]1ccc3Cl)([n]1c3c(c(Cl)cc1)ccc1c3[n]2ccc1Cl)(N=C=NC#N)N=C=NC#N |
| Title of publication |
Bis(4,7-dichloro-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(dicyanamido-κ<i>N</i>)copper(II) |
| Authors of publication |
Potočňák, Ivan; Pravcová, Zuzana; Trávníček, Zdeněk |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
m719 - m720 |
| a |
9.5484 ± 0.0002 Å |
| b |
16.6471 ± 0.0003 Å |
| c |
17.4906 ± 0.0003 Å |
| α |
90° |
| β |
97.316 ± 0.002° |
| γ |
90° |
| Cell volume |
2757.55 ± 0.09 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0392 |
| Residual factor for significantly intense reflections |
0.0308 |
| Weighted residual factors for significantly intense reflections |
0.0785 |
| Weighted residual factors for all reflections included in the refinement |
0.0816 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226173.html