Information card for entry 2226263
| Chemical name |
Ethyl 2-{3-[(2-chloro-1,3-thiazol-5-yl)methyl]- 4-nitroimino-1,3,5-triazinan-1-yl}acetate |
| Formula |
C11 H15 Cl N6 O4 S |
| Calculated formula |
C11 H15 Cl N6 O4 S |
| SMILES |
C(C(=O)OCC)N1CN/C(=N\N(=O)=O)N(C1)Cc1cnc(Cl)s1 |
| Title of publication |
Ethyl 2-{3-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-nitroimino-1,3,5-triazinan-1-yl}acetate |
| Authors of publication |
Sun, Chuan-wen; Zhu, Jun; Jin, Jia; Yang, Ding-rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1457 - o1458 |
| a |
8.5066 ± 0.0006 Å |
| b |
9.1114 ± 0.0007 Å |
| c |
10.9071 ± 0.0008 Å |
| α |
100.488 ± 0.002° |
| β |
98.416 ± 0.003° |
| γ |
101.281 ± 0.003° |
| Cell volume |
800.55 ± 0.1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0572 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for significantly intense reflections |
0.1215 |
| Weighted residual factors for all reflections included in the refinement |
0.1278 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226263.html