Information card for entry 2226301
| Chemical name |
(3a<i>RS</i>,4<i>SR</i>,7<i>RS</i>,7a<i>SR</i>)-2-(Tricyclo[3.3.1.1^3,7^]decan- 1-yl)-4,5,6,7-tetrahydro-4,7-epoxyisoindoline-1,3-dione |
| Formula |
C18 H23 N O3 |
| Calculated formula |
C18 H23 N O3 |
| SMILES |
N1(C(=O)[C@H]2[C@H]3O[C@@H]([C@H]2C1=O)CC3)C12CC3CC(C2)CC(C1)C3 |
| Title of publication |
(3a<i>RS</i>,4<i>SR</i>,7<i>RS</i>,7a<i>SR</i>)-2-(Tricyclo[3.3.1.1^3,7^]decan-1-yl)-4,5,6,7-tetrahydro-4,7-epoxyisoindoline-1,3-dione |
| Authors of publication |
Tan, Zaiyou; Luo, Lin; Zhu, Erjia; Yan, Ruisi; Lin, Zhuohui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1374 |
| a |
12.2216 ± 0.0004 Å |
| b |
12.3465 ± 0.0004 Å |
| c |
16.1646 ± 0.0006 Å |
| α |
77.057 ± 0.003° |
| β |
89.906 ± 0.003° |
| γ |
69.19 ± 0.003° |
| Cell volume |
2213.95 ± 0.14 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0404 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for significantly intense reflections |
0.0954 |
| Weighted residual factors for all reflections included in the refinement |
0.0982 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226301.html