Information card for entry 2226380
| Chemical name |
4-[2-(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hydrazin-1-yl]benzonitrile |
| Formula |
C13 H11 N3 O4 |
| Calculated formula |
C13 H11 N3 O4 |
| SMILES |
O1C(OC(=O)C(=N\Nc2ccc(cc2)C#N)/C1=O)(C)C |
| Title of publication |
4-[2-(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hydrazin-1-yl]benzonitrile |
| Authors of publication |
Çolak, Naki; Yıldırır, Yılmaz; Tercan, Barış; Ermiş, Emel; Hökelek, Tuncer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1784 - o1785 |
| a |
9.7617 ± 0.0002 Å |
| b |
11.0023 ± 0.0002 Å |
| c |
11.4753 ± 0.0003 Å |
| α |
90° |
| β |
93.796 ± 0.001° |
| γ |
90° |
| Cell volume |
1229.76 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0467 |
| Residual factor for significantly intense reflections |
0.0382 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Weighted residual factors for all reflections included in the refinement |
0.1076 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226380.html