Information card for entry 2226393
| Common name |
4,4'-methylenebis(2,6-diethylbenzonitrile) |
| Chemical name |
2,2',6,6'-Tetraethyl-4,4'-methylenedibenzonitrile |
| Formula |
C23 H26 N2 |
| Calculated formula |
C23 H26 N2 |
| SMILES |
CCc1cc(Cc2cc(CC)c(c(c2)CC)C#N)cc(c1C#N)CC |
| Title of publication |
2,2',6,6'-Tetraethyl-4,4'-methylenedibenzonitrile |
| Authors of publication |
Yuan, Jingjing; Zhu, Yanping |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1523 |
| a |
16.016 ± 0.003 Å |
| b |
9.3218 ± 0.0019 Å |
| c |
13.977 ± 0.003 Å |
| α |
90° |
| β |
115.55 ± 0.03° |
| γ |
90° |
| Cell volume |
1882.7 ± 0.8 Å3 |
| Cell temperature |
290 ± 2 K |
| Ambient diffraction temperature |
290 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.064 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for significantly intense reflections |
0.0919 |
| Weighted residual factors for all reflections included in the refinement |
0.1109 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.156 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mokα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226393.html