Information card for entry 2226439
| Common name |
Neoirietriol |
| Chemical name |
(1<i>R</i>,4<i>S</i>,4a<i>S</i>,7<i>R</i>,8a<i>R</i>)-4-bromo-7- [(1<i>S</i>,3<i>R</i>)-3-bromo-1,2,2-trimethylcyclopentyl]-1,4a- dimethyldecahydronaphthalene-1,7,8a-triol |
| Formula |
C20 H34 Br2 O3 |
| Calculated formula |
C20 H34 Br2 O3 |
| SMILES |
Br[C@H]1CC[C@@](O)([C@@]2(O)C[C@](O)(CC[C@]12C)[C@]1(CC[C@@H](Br)C1(C)C)C)C |
| Title of publication |
Neoirietriol |
| Authors of publication |
Takahashi, Hiroki; Takahashi, Yoshinori; Suzuki, Minoru; Abe, Tsuyoshi; Masuda, Michio |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1795 |
| a |
7.5026 ± 0.0002 Å |
| b |
11.3985 ± 0.0003 Å |
| c |
12.1498 ± 0.0005 Å |
| α |
90° |
| β |
94.978 ± 0.0003° |
| γ |
90° |
| Cell volume |
1035.11 ± 0.06 Å3 |
| Cell temperature |
296.1 K |
| Ambient diffraction temperature |
296.1 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for significantly intense reflections |
0.0619 |
| Weighted residual factors for all reflections included in the refinement |
0.1506 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.141 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226439.html