Information card for entry 2226502
| Chemical name |
Methyl 2,6-bis[(5-bromo-4,6-dimethoxypyrimidin-2-yl)oxy]benzoate |
| Formula |
C20 H18 Br2 N4 O8 |
| Calculated formula |
C20 H18 Br2 N4 O8 |
| SMILES |
Brc1c(OC)nc(Oc2cccc(Oc3nc(OC)c(Br)c(OC)n3)c2C(=O)OC)nc1OC |
| Title of publication |
Methyl 2,6-bis[(5-bromo-4,6-dimethoxypyrimidin-2-yl)oxy]benzoate |
| Authors of publication |
Fun, Hoong-Kun; Goh, Jia Hao; Rai, Sankappa; Isloor, Arun M.; Shetty, Prakash |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1871 |
| a |
29.972 ± 0.005 Å |
| b |
8.1392 ± 0.0012 Å |
| c |
23.061 ± 0.003 Å |
| α |
90° |
| β |
123.12 ± 0.003° |
| γ |
90° |
| Cell volume |
4711.7 ± 1.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1386 |
| Residual factor for significantly intense reflections |
0.0641 |
| Weighted residual factors for significantly intense reflections |
0.1839 |
| Weighted residual factors for all reflections included in the refinement |
0.2543 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226502.html