Information card for entry 2226567
| Chemical name |
(4<i>S</i>)-4-Benzyl-<i>N</i>-{[(4<i>S</i>)-4-benzyl-2-oxo-1,3-oxazolidin- 3-yl]sulfonyl}-2-oxo-1,3-oxazolidine-3-carboxamide |
| Formula |
C21 H21 N3 O7 S |
| Calculated formula |
C21 H21 N3 O7 S |
| SMILES |
S(=O)(=O)(N1[C@@H](Cc2ccccc2)COC1=O)NC(=O)N1[C@H](COC1=O)Cc1ccccc1 |
| Title of publication |
(4<i>S</i>)-4-Benzyl-<i>N</i>-{[(4<i>S</i>)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]sulfonyl}-2-oxo-1,3-oxazolidine-3-carboxamide |
| Authors of publication |
Berredjem, Malika; Allaoui, Assia; Direm, Amani; Aouf, Noureddine; Benali-Cherif, Nourredine |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1611 - o1612 |
| a |
10.4262 ± 0.0003 Å |
| b |
9.7171 ± 0.0002 Å |
| c |
10.7402 ± 0.0002 Å |
| α |
90° |
| β |
101.504 ± 0.002° |
| γ |
90° |
| Cell volume |
1066.26 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0841 |
| Residual factor for significantly intense reflections |
0.0536 |
| Weighted residual factors for significantly intense reflections |
0.133 |
| Weighted residual factors for all reflections included in the refinement |
0.152 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.001 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226567.html