Information card for entry 2226712
| Chemical name |
Bis[<i>N</i>,<i>N</i>-dimethyl-1-(10<i>H</i>-pyrido[3,2- <i>b</i>][1,4]benzothiazin-10-yl)propan-2-aminium] tetrakis(thiocyanato-κ<i>N</i>)cobaltate(II) |
| Formula |
C36 H40 Co N10 S6 |
| Calculated formula |
C36 H40 Co N10 S6 |
| SMILES |
c1ccc2c(n1)N(c1c(cccc1)S2)CC([NH+](C)C)C.N(=C=S)[Co](N=C=S)(N=C=S)N=C=S.c1ccc2c(n1)N(c1c(cccc1)S2)CC([NH+](C)C)C |
| Title of publication |
Bis[<i>N</i>,<i>N</i>-dimethyl-1-(10<i>H</i>-pyrido[3,2-<i>b</i>][1,4]benzothiazin-10-yl)propan-2-aminium] tetrakis(thiocyanato-κ<i>N</i>)cobaltate(II) |
| Authors of publication |
Arunkashi, H. K.; Jeyaseelan, S.; Vepuri, Suresh Babu; Revanasiddappa, H. D.; Devarajegowda, H. C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
m772 - m773 |
| a |
25.242 ± 0.0004 Å |
| b |
11.4357 ± 0.0002 Å |
| c |
14.5939 ± 0.0002 Å |
| α |
90° |
| β |
98.557 ± 0.001° |
| γ |
90° |
| Cell volume |
4165.78 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0611 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.0996 |
| Weighted residual factors for all reflections included in the refinement |
0.1143 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226712.html