Information card for entry 2226901
| Chemical name |
3-Ethyl-4-phenoxy-1-(2,2,2-trifluoroethyl)-1<i>H</i>-pyrazol-5-ol |
| Formula |
C13 H13 F3 N2 O2 |
| Calculated formula |
C13 H13 F3 N2 O2 |
| SMILES |
CCc1nn(c(c1Oc1ccccc1)O)CC(F)(F)F |
| Title of publication |
3-Ethyl-4-phenoxy-1-(2,2,2-trifluoroethyl)-1<i>H</i>-pyrazol-5-ol |
| Authors of publication |
Shahani, Tara; Fun, Hoong-Kun; Ragavan, R. Venkat; Vijayakumar, V.; Sarveswari, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o1937 - o1938 |
| a |
9.349 ± 0.0018 Å |
| b |
14.712 ± 0.003 Å |
| c |
20.319 ± 0.004 Å |
| α |
90° |
| β |
113.889 ± 0.008° |
| γ |
90° |
| Cell volume |
2555.3 ± 0.9 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0638 |
| Residual factor for significantly intense reflections |
0.0457 |
| Weighted residual factors for significantly intense reflections |
0.1358 |
| Weighted residual factors for all reflections included in the refinement |
0.1563 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226901.html